C38H36N2O4S — CID 90890174
[4-[3-[(2-phenoxyphenyl)carbamoyl-(3-phenylpropyl)amino]phenyl]sulfanylphenyl] butanoate (PubChem CID 90890174) has the molecular formula C38H36N2O4S and a molecular weight of 616.78 g/mol. Its IUPAC name is [4-[3-[(2-phenoxyphenyl)carbamoyl-(3-phenylpropyl)amino]phenyl]sulfanylphenyl] butanoate.
| Compound Name | [4-[3-[(2-phenoxyphenyl)carbamoyl-(3-phenylpropyl)amino]phenyl]sulfanylphenyl] butanoate |
|---|---|
| PubChem CID | 90890174 |
| Molecular Formula | C38H36N2O4S |
| Molecular Weight | 616.78 g/mol |
| Exact Mass | 616.24 |
| IUPAC Name | [4-[3-[(2-phenoxyphenyl)carbamoyl-(3-phenylpropyl)amino]phenyl]sulfanylphenyl] butanoate |
| SMILES | CCCC(=O)Oc1ccc(Sc2cccc(N(CCCc3ccccc3)C(=O)Nc3ccccc3Oc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C38H36N2O4S/c1-2-13-37(41)44-32-23-25-33(26-24-32)45-34-20-11-17-30(28-34)40(27-12-16-29-14-5-3-6-15-29)38(42)39-35-21-9-10-22-36(35)43-31-18-7-4-8-19-31/h3-11,14-15,17-26,28H,2,12-13,16,27H2,1H3,(H,39,42) |
| InChIKey | UCZIKDCEYKQCFI-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.78 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|