C32H32N2O3S — CID 10436854
[3-[3-[benzylcarbamoyl(1-phenylethyl)amino]phenyl]sulfanylphenyl] butanoate (PubChem CID 10436854) has the molecular formula C32H32N2O3S and a molecular weight of 524.69 g/mol. Its IUPAC name is [3-[3-[benzylcarbamoyl(1-phenylethyl)amino]phenyl]sulfanylphenyl] butanoate.
| Compound Name | [3-[3-[benzylcarbamoyl(1-phenylethyl)amino]phenyl]sulfanylphenyl] butanoate |
|---|---|
| PubChem CID | 10436854 |
| Molecular Formula | C32H32N2O3S |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | [3-[3-[benzylcarbamoyl(1-phenylethyl)amino]phenyl]sulfanylphenyl] butanoate |
| SMILES | CCCC(=O)Oc1cccc(Sc2cccc(N(C(=O)NCc3ccccc3)C(C)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C32H32N2O3S/c1-3-12-31(35)37-28-18-11-20-30(22-28)38-29-19-10-17-27(21-29)34(24(2)26-15-8-5-9-16-26)32(36)33-23-25-13-6-4-7-14-25/h4-11,13-22,24H,3,12,23H2,1-2H3,(H,33,36) |
| InChIKey | VEZTUJSPUMVJJS-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|