C33H34N2O3S — CID 90692041
[4-[4-[benzylcarbamoyl(3-phenylpropyl)amino]phenyl]sulfanylphenyl] butanoate (PubChem CID 90692041) has the molecular formula C33H34N2O3S and a molecular weight of 538.71 g/mol. Its IUPAC name is [4-[4-[benzylcarbamoyl(3-phenylpropyl)amino]phenyl]sulfanylphenyl] butanoate.
| Compound Name | [4-[4-[benzylcarbamoyl(3-phenylpropyl)amino]phenyl]sulfanylphenyl] butanoate |
|---|---|
| PubChem CID | 90692041 |
| Molecular Formula | C33H34N2O3S |
| Molecular Weight | 538.71 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | [4-[4-[benzylcarbamoyl(3-phenylpropyl)amino]phenyl]sulfanylphenyl] butanoate |
| SMILES | CCCC(=O)Oc1ccc(Sc2ccc(N(CCCc3ccccc3)C(=O)NCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C33H34N2O3S/c1-2-10-32(36)38-29-18-22-31(23-19-29)39-30-20-16-28(17-21-30)35(24-9-15-26-11-5-3-6-12-26)33(37)34-25-27-13-7-4-8-14-27/h3-8,11-14,16-23H,2,9-10,15,24-25H2,1H3,(H,34,37) |
| InChIKey | QMDJRMFHPBVCEK-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.71 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|