C29H42N2O3S — CID 91478423
[4-[3-[heptyl(heptylcarbamoyl)amino]phenyl]sulfanylphenyl] acetate (PubChem CID 91478423) has the molecular formula C29H42N2O3S and a molecular weight of 498.73 g/mol. Its IUPAC name is [4-[3-[heptyl(heptylcarbamoyl)amino]phenyl]sulfanylphenyl] acetate.
| Compound Name | [4-[3-[heptyl(heptylcarbamoyl)amino]phenyl]sulfanylphenyl] acetate |
|---|---|
| PubChem CID | 91478423 |
| Molecular Formula | C29H42N2O3S |
| Molecular Weight | 498.73 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | [4-[3-[heptyl(heptylcarbamoyl)amino]phenyl]sulfanylphenyl] acetate |
| SMILES | CCCCCCCNC(=O)N(CCCCCCC)c1cccc(Sc2ccc(OC(C)=O)cc2)c1 |
| InChI | InChI=1S/C29H42N2O3S/c1-4-6-8-10-12-21-30-29(33)31(22-13-11-9-7-5-2)25-15-14-16-28(23-25)35-27-19-17-26(18-20-27)34-24(3)32/h14-20,23H,4-13,21-22H2,1-3H3,(H,30,33) |
| InChIKey | OVFPCXHTXXTQIT-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.73 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|