C29H32N2O3S — CID 10368241
2-[3-[3-[cyclohexylcarbamoyl(2-phenylethyl)amino]phenyl]sulfanylphenyl]acetic acid (PubChem CID 10368241) has the molecular formula C29H32N2O3S and a molecular weight of 488.65 g/mol. Its IUPAC name is 2-[3-[3-[cyclohexylcarbamoyl(2-phenylethyl)amino]phenyl]sulfanylphenyl]acetic acid.
| Compound Name | 2-[3-[3-[cyclohexylcarbamoyl(2-phenylethyl)amino]phenyl]sulfanylphenyl]acetic acid |
|---|---|
| PubChem CID | 10368241 |
| Molecular Formula | C29H32N2O3S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 2-[3-[3-[cyclohexylcarbamoyl(2-phenylethyl)amino]phenyl]sulfanylphenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(Sc2cccc(N(CCc3ccccc3)C(=O)NC3CCCCC3)c2)c1 |
| InChI | InChI=1S/C29H32N2O3S/c32-28(33)20-23-11-7-15-26(19-23)35-27-16-8-14-25(21-27)31(18-17-22-9-3-1-4-10-22)29(34)30-24-12-5-2-6-13-24/h1,3-4,7-11,14-16,19,21,24H,2,5-6,12-13,17-18,20H2,(H,30,34)(H,32,33) |
| InChIKey | KHALDQUFIHVIMI-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |