C18H15N5O2S2 — CID 88546418
4-[[(cyanoamino)-[ethyl-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)amino]methylidene]amino]benzoic acid (PubChem CID 88546418) has the molecular formula C18H15N5O2S2 and a molecular weight of 397.49 g/mol. Its IUPAC name is 4-[[(cyanoamino)-[ethyl-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)amino]methylidene]amino]benzoic acid.
| Compound Name | 4-[[(cyanoamino)-[ethyl-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)amino]methylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 88546418 |
| Molecular Formula | C18H15N5O2S2 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 4-[[(cyanoamino)-[ethyl-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)amino]methylidene]amino]benzoic acid |
| SMILES | CCN(/C(=N/c1ccc(C(=O)O)cc1)NC#N)c1ccc2[nH]c(=S)sc2c1 |
| InChI | InChI=1S/C18H15N5O2S2/c1-2-23(13-7-8-14-15(9-13)27-18(26)22-14)17(20-10-19)21-12-5-3-11(4-6-12)16(24)25/h3-9H,2H2,1H3,(H,20,21)(H,22,26)(H,24,25) |
| InChIKey | ZIPNVHDGIJCKHO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 104.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|