C33H32F3N5O3 — CID 142253914
3-[[4-[[N-[N-cyano-N'-[3-methyl-5-(trifluoromethyl)phenyl]carbamimidoyl]-4-(cyclohexen-1-yl)anilino]methyl]benzoyl]amino]propanoic acid (PubChem CID 142253914) has the molecular formula C33H32F3N5O3 and a molecular weight of 603.64 g/mol. Its IUPAC name is 3-[[4-[[N-[N-cyano-N'-[3-methyl-5-(trifluoromethyl)phenyl]carbamimidoyl]-4-(cyclohexen-1-yl)anilino]methyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[[N-[N-cyano-N'-[3-methyl-5-(trifluoromethyl)phenyl]carbamimidoyl]-4-(cyclohexen-1-yl)anilino]methyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 142253914 |
| Molecular Formula | C33H32F3N5O3 |
| Molecular Weight | 603.64 g/mol |
| Exact Mass | 603.25 |
| IUPAC Name | 3-[[4-[[N-[N-cyano-N'-[3-methyl-5-(trifluoromethyl)phenyl]carbamimidoyl]-4-(cyclohexen-1-yl)anilino]methyl]benzoyl]amino]propanoic acid |
| SMILES | Cc1cc(/N=C(\NC#N)N(Cc2ccc(C(=O)NCCC(=O)O)cc2)c2ccc(C3=CCCCC3)cc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C33H32F3N5O3/c1-22-17-27(33(34,35)36)19-28(18-22)40-32(39-21-37)41(29-13-11-25(12-14-29)24-5-3-2-4-6-24)20-23-7-9-26(10-8-23)31(44)38-16-15-30(42)43/h5,7-14,17-19H,2-4,6,15-16,20H2,1H3,(H,38,44)(H,39,40)(H,42,43) |
| InChIKey | SRLXNMRMQKXEKJ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.64 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|