C33H38ClN5O3 — CID 67765275
3-[[4-[[N-[N'-(aminomethyl)-N-[1-(4-chlorophenyl)ethyl]carbamimidoyl]-4-(cyclohexen-1-yl)anilino]methyl]benzoyl]amino]propanoic acid (PubChem CID 67765275) has the molecular formula C33H38ClN5O3 and a molecular weight of 588.15 g/mol. Its IUPAC name is 3-[[4-[[N-[N'-(aminomethyl)-N-[1-(4-chlorophenyl)ethyl]carbamimidoyl]-4-(cyclohexen-1-yl)anilino]methyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[[N-[N'-(aminomethyl)-N-[1-(4-chlorophenyl)ethyl]carbamimidoyl]-4-(cyclohexen-1-yl)anilino]methyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67765275 |
| Molecular Formula | C33H38ClN5O3 |
| Molecular Weight | 588.15 g/mol |
| Exact Mass | 587.27 |
| IUPAC Name | 3-[[4-[[N-[N'-(aminomethyl)-N-[1-(4-chlorophenyl)ethyl]carbamimidoyl]-4-(cyclohexen-1-yl)anilino]methyl]benzoyl]amino]propanoic acid |
| SMILES | CC(NC(=NCN)N(Cc1ccc(C(=O)NCCC(=O)O)cc1)c1ccc(C2=CCCCC2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C33H38ClN5O3/c1-23(25-11-15-29(34)16-12-25)38-33(37-22-35)39(30-17-13-27(14-18-30)26-5-3-2-4-6-26)21-24-7-9-28(10-8-24)32(42)36-20-19-31(40)41/h5,7-18,23H,2-4,6,19-22,35H2,1H3,(H,36,42)(H,37,38)(H,40,41) |
| InChIKey | OQWBGCNOUYEWIC-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 120.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.15 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|