C32H36ClN5O4 — CID 67489130
(2R)-3-[[4-[[N-[N-amino-N'-[1-(4-chlorophenyl)ethyl]carbamimidoyl]-4-(cyclohexen-1-yl)anilino]methyl]benzoyl]amino]-2-hydroxypropanoic acid (PubChem CID 67489130) has the molecular formula C32H36ClN5O4 and a molecular weight of 590.12 g/mol. Its IUPAC name is (2R)-3-[[4-[[N-[N-amino-N'-[1-(4-chlorophenyl)ethyl]carbamimidoyl]-4-(cyclohexen-1-yl)anilino]methyl]benzoyl]amino]-2-hydroxypropanoic acid.
| Compound Name | (2R)-3-[[4-[[N-[N-amino-N'-[1-(4-chlorophenyl)ethyl]carbamimidoyl]-4-(cyclohexen-1-yl)anilino]methyl]benzoyl]amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 67489130 |
| Molecular Formula | C32H36ClN5O4 |
| Molecular Weight | 590.12 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | (2R)-3-[[4-[[N-[N-amino-N'-[1-(4-chlorophenyl)ethyl]carbamimidoyl]-4-(cyclohexen-1-yl)anilino]methyl]benzoyl]amino]-2-hydroxypropanoic acid |
| SMILES | CC(/N=C(\NN)N(Cc1ccc(C(=O)NC[C@@H](O)C(=O)O)cc1)c1ccc(C2=CCCCC2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H36ClN5O4/c1-21(23-11-15-27(33)16-12-23)36-32(37-34)38(28-17-13-25(14-18-28)24-5-3-2-4-6-24)20-22-7-9-26(10-8-22)30(40)35-19-29(39)31(41)42/h5,7-18,21,29,39H,2-4,6,19-20,34H2,1H3,(H,35,40)(H,36,37)(H,41,42)/t21?,29-/m1/s1 |
| InChIKey | BLRUMQCGAHIBRX-NLLRYDLESA-N |
| XLogP | 5.06 |
| TPSA | 140.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.12 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|