C33H30F6N4O6 — CID 59123112
(2R)-3-[[4-[[N-[(Z)-1-[3,5-bis(trifluoromethyl)anilino]-2-nitroethenyl]-4-(cyclohexen-1-yl)anilino]methyl]benzoyl]amino]-2-hydroxypropanoic acid (PubChem CID 59123112) has the molecular formula C33H30F6N4O6 and a molecular weight of 692.61 g/mol. Its IUPAC name is (2R)-3-[[4-[[N-[(Z)-1-[3,5-bis(trifluoromethyl)anilino]-2-nitroethenyl]-4-(cyclohexen-1-yl)anilino]methyl]benzoyl]amino]-2-hydroxypropanoic acid.
| Compound Name | (2R)-3-[[4-[[N-[(Z)-1-[3,5-bis(trifluoromethyl)anilino]-2-nitroethenyl]-4-(cyclohexen-1-yl)anilino]methyl]benzoyl]amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 59123112 |
| Molecular Formula | C33H30F6N4O6 |
| Molecular Weight | 692.61 g/mol |
| Exact Mass | 692.21 |
| IUPAC Name | (2R)-3-[[4-[[N-[(Z)-1-[3,5-bis(trifluoromethyl)anilino]-2-nitroethenyl]-4-(cyclohexen-1-yl)anilino]methyl]benzoyl]amino]-2-hydroxypropanoic acid |
| SMILES | O=C(NC[C@@H](O)C(=O)O)c1ccc(CN(/C(=C\[N+](=O)[O-])Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccc(C3=CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C33H30F6N4O6/c34-32(35,36)24-14-25(33(37,38)39)16-26(15-24)41-29(19-43(48)49)42(27-12-10-22(11-13-27)21-4-2-1-3-5-21)18-20-6-8-23(9-7-20)30(45)40-17-28(44)31(46)47/h4,6-16,19,28,41,44H,1-3,5,17-18H2,(H,40,45)(H,46,47)/b29-19-/t28-/m1/s1 |
| InChIKey | IABHXIONPUEZNH-JWOUUYIMSA-N |
| XLogP | 7.05 |
| TPSA | 145.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.61 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|