C30H28F2N4O6 — CID 20584921
3-[[4-[[4-(cyclohexen-1-yl)-N-[(4-fluoro-3-nitrophenyl)carbamoyl]anilino]methyl]benzoyl]amino]-2-fluoropropanoic acid (PubChem CID 20584921) has the molecular formula C30H28F2N4O6 and a molecular weight of 578.57 g/mol. Its IUPAC name is 3-[[4-[[4-(cyclohexen-1-yl)-N-[(4-fluoro-3-nitrophenyl)carbamoyl]anilino]methyl]benzoyl]amino]-2-fluoropropanoic acid.
| Compound Name | 3-[[4-[[4-(cyclohexen-1-yl)-N-[(4-fluoro-3-nitrophenyl)carbamoyl]anilino]methyl]benzoyl]amino]-2-fluoropropanoic acid |
|---|---|
| PubChem CID | 20584921 |
| Molecular Formula | C30H28F2N4O6 |
| Molecular Weight | 578.57 g/mol |
| Exact Mass | 578.20 |
| IUPAC Name | 3-[[4-[[4-(cyclohexen-1-yl)-N-[(4-fluoro-3-nitrophenyl)carbamoyl]anilino]methyl]benzoyl]amino]-2-fluoropropanoic acid |
| SMILES | O=C(NCC(F)C(=O)O)c1ccc(CN(C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)c2ccc(C3=CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C30H28F2N4O6/c31-25-15-12-23(16-27(25)36(41)42)34-30(40)35(24-13-10-21(11-14-24)20-4-2-1-3-5-20)18-19-6-8-22(9-7-19)28(37)33-17-26(32)29(38)39/h4,6-16,26H,1-3,5,17-18H2,(H,33,37)(H,34,40)(H,38,39) |
| InChIKey | XNPNNYTZHJZVCN-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 141.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|