C36H39FN4O6 — CID 20584785
3-[[4-[[N-[(2-butyl-1,3-dioxoisoindol-5-yl)carbamoyl]-4-cyclohexylanilino]methyl]benzoyl]amino]-2-fluoropropanoic acid (PubChem CID 20584785) has the molecular formula C36H39FN4O6 and a molecular weight of 642.73 g/mol. Its IUPAC name is 3-[[4-[[N-[(2-butyl-1,3-dioxoisoindol-5-yl)carbamoyl]-4-cyclohexylanilino]methyl]benzoyl]amino]-2-fluoropropanoic acid.
| Compound Name | 3-[[4-[[N-[(2-butyl-1,3-dioxoisoindol-5-yl)carbamoyl]-4-cyclohexylanilino]methyl]benzoyl]amino]-2-fluoropropanoic acid |
|---|---|
| PubChem CID | 20584785 |
| Molecular Formula | C36H39FN4O6 |
| Molecular Weight | 642.73 g/mol |
| Exact Mass | 642.29 |
| IUPAC Name | 3-[[4-[[N-[(2-butyl-1,3-dioxoisoindol-5-yl)carbamoyl]-4-cyclohexylanilino]methyl]benzoyl]amino]-2-fluoropropanoic acid |
| SMILES | CCCCN1C(=O)c2ccc(NC(=O)N(Cc3ccc(C(=O)NCC(F)C(=O)O)cc3)c3ccc(C4CCCCC4)cc3)cc2C1=O |
| InChI | InChI=1S/C36H39FN4O6/c1-2-3-19-40-33(43)29-18-15-27(20-30(29)34(40)44)39-36(47)41(28-16-13-25(14-17-28)24-7-5-4-6-8-24)22-23-9-11-26(12-10-23)32(42)38-21-31(37)35(45)46/h9-18,20,24,31H,2-8,19,21-22H2,1H3,(H,38,42)(H,39,47)(H,45,46) |
| InChIKey | YIHIBEIJUYPJEU-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.73 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|