C36H38N4O6 — CID 23549646
3-[[4-[[4-cyclohexyl-N-[[2-(cyclopropylmethyl)-1,3-dioxoisoindol-5-yl]carbamoyl]anilino]methyl]benzoyl]amino]propanoic acid (PubChem CID 23549646) has the molecular formula C36H38N4O6 and a molecular weight of 622.72 g/mol. Its IUPAC name is 3-[[4-[[4-cyclohexyl-N-[[2-(cyclopropylmethyl)-1,3-dioxoisoindol-5-yl]carbamoyl]anilino]methyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[[4-cyclohexyl-N-[[2-(cyclopropylmethyl)-1,3-dioxoisoindol-5-yl]carbamoyl]anilino]methyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 23549646 |
| Molecular Formula | C36H38N4O6 |
| Molecular Weight | 622.72 g/mol |
| Exact Mass | 622.28 |
| IUPAC Name | 3-[[4-[[4-cyclohexyl-N-[[2-(cyclopropylmethyl)-1,3-dioxoisoindol-5-yl]carbamoyl]anilino]methyl]benzoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccc(CN(C(=O)Nc2ccc3c(c2)C(=O)N(CC2CC2)C3=O)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C36H38N4O6/c41-32(42)18-19-37-33(43)27-10-8-24(9-11-27)21-39(29-15-12-26(13-16-29)25-4-2-1-3-5-25)36(46)38-28-14-17-30-31(20-28)35(45)40(34(30)44)22-23-6-7-23/h8-17,20,23,25H,1-7,18-19,21-22H2,(H,37,43)(H,38,46)(H,41,42) |
| InChIKey | GTQYWFVLEHVJLW-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.72 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|