C27H27BrN2O3 — CID 22311090
4-[[N-[(3-bromophenyl)carbamoyl]-4-cyclohexylanilino]methyl]benzoic acid (PubChem CID 22311090) has the molecular formula C27H27BrN2O3 and a molecular weight of 507.43 g/mol. Its IUPAC name is 4-[[N-[(3-bromophenyl)carbamoyl]-4-cyclohexylanilino]methyl]benzoic acid.
| Compound Name | 4-[[N-[(3-bromophenyl)carbamoyl]-4-cyclohexylanilino]methyl]benzoic acid |
|---|---|
| PubChem CID | 22311090 |
| Molecular Formula | C27H27BrN2O3 |
| Molecular Weight | 507.43 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 4-[[N-[(3-bromophenyl)carbamoyl]-4-cyclohexylanilino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN(C(=O)Nc2cccc(Br)c2)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C27H27BrN2O3/c28-23-7-4-8-24(17-23)29-27(33)30(18-19-9-11-22(12-10-19)26(31)32)25-15-13-21(14-16-25)20-5-2-1-3-6-20/h4,7-17,20H,1-3,5-6,18H2,(H,29,33)(H,31,32) |
| InChIKey | DWEIJWYATQWPDB-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.43 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |