C28H29Br2N6O2+ — CID 142027395
[N'-[4-[[4-cyclohexyl-N-[(3,5-dibromophenyl)carbamoyl]anilino]methyl]benzoyl]carbamimidoyl]iminoazanium (PubChem CID 142027395) has the molecular formula C28H29Br2N6O2+ and a molecular weight of 641.39 g/mol. Its IUPAC name is [N'-[4-[[4-cyclohexyl-N-[(3,5-dibromophenyl)carbamoyl]anilino]methyl]benzoyl]carbamimidoyl]iminoazanium.
| Compound Name | [N'-[4-[[4-cyclohexyl-N-[(3,5-dibromophenyl)carbamoyl]anilino]methyl]benzoyl]carbamimidoyl]iminoazanium |
|---|---|
| PubChem CID | 142027395 |
| Molecular Formula | C28H29Br2N6O2+ |
| Molecular Weight | 641.39 g/mol |
| Exact Mass | 639.07 |
| IUPAC Name | [N'-[4-[[4-cyclohexyl-N-[(3,5-dibromophenyl)carbamoyl]anilino]methyl]benzoyl]carbamimidoyl]iminoazanium |
| SMILES | N/C(N=[NH2+])=N/C(=O)c1ccc(CN(C(=O)Nc2cc(Br)cc(Br)c2)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C28H28Br2N6O2/c29-22-14-23(30)16-24(15-22)33-28(38)36(25-12-10-20(11-13-25)19-4-2-1-3-5-19)17-18-6-8-21(9-7-18)26(37)34-27(31)35-32/h6-16,19,32H,1-5,17H2,(H,33,38)(H2,31,34,37)/p+1 |
| InChIKey | JXVSSQALEZVLGL-UHFFFAOYSA-O |
| XLogP | 6.16 |
| TPSA | 125.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.39 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|