C33H39N7O3 — CID 142027387
3-[[[4-[[amino(diazenyl)methylidene]carbamoyl]phenyl]methyl-(4-cyclohexylphenyl)carbamoyl]amino]-N-butylbenzamide (PubChem CID 142027387) has the molecular formula C33H39N7O3 and a molecular weight of 581.72 g/mol. Its IUPAC name is 3-[[[4-[[amino(diazenyl)methylidene]carbamoyl]phenyl]methyl-(4-cyclohexylphenyl)carbamoyl]amino]-N-butylbenzamide.
| Compound Name | 3-[[[4-[[amino(diazenyl)methylidene]carbamoyl]phenyl]methyl-(4-cyclohexylphenyl)carbamoyl]amino]-N-butylbenzamide |
|---|---|
| PubChem CID | 142027387 |
| Molecular Formula | C33H39N7O3 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.31 |
| IUPAC Name | 3-[[[4-[[amino(diazenyl)methylidene]carbamoyl]phenyl]methyl-(4-cyclohexylphenyl)carbamoyl]amino]-N-butylbenzamide |
| SMILES | [H]/N=N/C(N)=N\C(=O)c1ccc(CN(C(=O)Nc2cccc(C(=O)NCCCC)c2)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C33H39N7O3/c1-2-3-20-36-30(41)27-10-7-11-28(21-27)37-33(43)40(29-18-16-25(17-19-29)24-8-5-4-6-9-24)22-23-12-14-26(15-13-23)31(42)38-32(34)39-35/h7,10-19,21,24,35H,2-6,8-9,20,22H2,1H3,(H,36,41)(H,37,43)(H2,34,38,42)/b39-35+ |
| InChIKey | LYJCSCWJVVINLZ-IGIMMJHKSA-N |
| XLogP | 6.99 |
| TPSA | 153.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|