C29H27F3N6O2S — CID 142027144
N-[amino(diazenyl)methylidene]-4-[[4-(cyclohexen-1-yl)-N-[[3-(trifluoromethylsulfanyl)phenyl]carbamoyl]anilino]methyl]benzamide (PubChem CID 142027144) has the molecular formula C29H27F3N6O2S and a molecular weight of 580.64 g/mol. Its IUPAC name is N-[amino(diazenyl)methylidene]-4-[[4-(cyclohexen-1-yl)-N-[[3-(trifluoromethylsulfanyl)phenyl]carbamoyl]anilino]methyl]benzamide.
| Compound Name | N-[amino(diazenyl)methylidene]-4-[[4-(cyclohexen-1-yl)-N-[[3-(trifluoromethylsulfanyl)phenyl]carbamoyl]anilino]methyl]benzamide |
|---|---|
| PubChem CID | 142027144 |
| Molecular Formula | C29H27F3N6O2S |
| Molecular Weight | 580.64 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | N-[amino(diazenyl)methylidene]-4-[[4-(cyclohexen-1-yl)-N-[[3-(trifluoromethylsulfanyl)phenyl]carbamoyl]anilino]methyl]benzamide |
| SMILES | [H]/N=N/C(N)=N\C(=O)c1ccc(CN(C(=O)Nc2cccc(SC(F)(F)F)c2)c2ccc(C3=CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C29H27F3N6O2S/c30-29(31,32)41-25-8-4-7-23(17-25)35-28(40)38(24-15-13-21(14-16-24)20-5-2-1-3-6-20)18-19-9-11-22(12-10-19)26(39)36-27(33)37-34/h4-5,7-17,34H,1-3,6,18H2,(H,35,40)(H2,33,36,39)/b37-34+ |
| InChIKey | KPCHKINMYOWIMW-NFSLGCCLSA-N |
| XLogP | 7.98 |
| TPSA | 124.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.64 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|