C29H27F4N7O2 — CID 142027215
N-[amino-[(Z)-aminodiazenyl]methylidene]-4-[[4-(cyclohexen-1-yl)-N-[[2-fluoro-5-(trifluoromethyl)phenyl]carbamoyl]anilino]methyl]benzamide (PubChem CID 142027215) has the molecular formula C29H27F4N7O2 and a molecular weight of 581.57 g/mol. Its IUPAC name is N-[amino-[(Z)-aminodiazenyl]methylidene]-4-[[4-(cyclohexen-1-yl)-N-[[2-fluoro-5-(trifluoromethyl)phenyl]carbamoyl]anilino]methyl]benzamide.
| Compound Name | N-[amino-[(Z)-aminodiazenyl]methylidene]-4-[[4-(cyclohexen-1-yl)-N-[[2-fluoro-5-(trifluoromethyl)phenyl]carbamoyl]anilino]methyl]benzamide |
|---|---|
| PubChem CID | 142027215 |
| Molecular Formula | C29H27F4N7O2 |
| Molecular Weight | 581.57 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | N-[amino-[(Z)-aminodiazenyl]methylidene]-4-[[4-(cyclohexen-1-yl)-N-[[2-fluoro-5-(trifluoromethyl)phenyl]carbamoyl]anilino]methyl]benzamide |
| SMILES | N/N=N\C(N)=N/C(=O)c1ccc(CN(C(=O)Nc2cc(C(F)(F)F)ccc2F)c2ccc(C3=CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C29H27F4N7O2/c30-24-15-12-22(29(31,32)33)16-25(24)36-28(42)40(23-13-10-20(11-14-23)19-4-2-1-3-5-19)17-18-6-8-21(9-7-18)26(41)37-27(34)38-39-35/h4,6-16H,1-3,5,17H2,(H,36,42)(H4,34,35,37,38,41) |
| InChIKey | MVSSVHYRKQBPKN-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.57 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|