C30H34N7O2+ — CID 142027566
[amino-[(Z)-aminodiazenyl]methylidene]-[4-[[4-(cyclohexen-1-yl)-N-[(2-methylphenyl)methylcarbamoyl]anilino]methyl]benzoyl]azanium (PubChem CID 142027566) has the molecular formula C30H34N7O2+ and a molecular weight of 524.65 g/mol. Its IUPAC name is [amino-[(Z)-aminodiazenyl]methylidene]-[4-[[4-(cyclohexen-1-yl)-N-[(2-methylphenyl)methylcarbamoyl]anilino]methyl]benzoyl]azanium.
| Compound Name | [amino-[(Z)-aminodiazenyl]methylidene]-[4-[[4-(cyclohexen-1-yl)-N-[(2-methylphenyl)methylcarbamoyl]anilino]methyl]benzoyl]azanium |
|---|---|
| PubChem CID | 142027566 |
| Molecular Formula | C30H34N7O2+ |
| Molecular Weight | 524.65 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | [amino-[(Z)-aminodiazenyl]methylidene]-[4-[[4-(cyclohexen-1-yl)-N-[(2-methylphenyl)methylcarbamoyl]anilino]methyl]benzoyl]azanium |
| SMILES | Cc1ccccc1CNC(=O)N(Cc1ccc(C(=O)/[NH+]=C(N)\N=N/N)cc1)c1ccc(C2=CCCCC2)cc1 |
| InChI | InChI=1S/C30H33N7O2/c1-21-7-5-6-10-26(21)19-33-30(39)37(27-17-15-24(16-18-27)23-8-3-2-4-9-23)20-22-11-13-25(14-12-22)28(38)34-29(31)35-36-32/h5-8,10-18H,2-4,9,19-20H2,1H3,(H,33,39)(H4,31,32,34,35,38)/p+1 |
| InChIKey | JCHAVHNFXKUPNG-UHFFFAOYSA-O |
| XLogP | 3.73 |
| TPSA | 140.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.65 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|