C30H30FN3O4S — CID 87419420
3-[[4-[[4-(cyclohexen-1-yl)-N-[(4-sulfanylphenyl)carbamoyl]anilino]methyl]benzoyl]amino]-2-fluoropropanoic acid (PubChem CID 87419420) has the molecular formula C30H30FN3O4S and a molecular weight of 547.65 g/mol. Its IUPAC name is 3-[[4-[[4-(cyclohexen-1-yl)-N-[(4-sulfanylphenyl)carbamoyl]anilino]methyl]benzoyl]amino]-2-fluoropropanoic acid.
| Compound Name | 3-[[4-[[4-(cyclohexen-1-yl)-N-[(4-sulfanylphenyl)carbamoyl]anilino]methyl]benzoyl]amino]-2-fluoropropanoic acid |
|---|---|
| PubChem CID | 87419420 |
| Molecular Formula | C30H30FN3O4S |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | 3-[[4-[[4-(cyclohexen-1-yl)-N-[(4-sulfanylphenyl)carbamoyl]anilino]methyl]benzoyl]amino]-2-fluoropropanoic acid |
| SMILES | O=C(NCC(F)C(=O)O)c1ccc(CN(C(=O)Nc2ccc(S)cc2)c2ccc(C3=CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C30H30FN3O4S/c31-27(29(36)37)18-32-28(35)23-8-6-20(7-9-23)19-34(30(38)33-24-12-16-26(39)17-13-24)25-14-10-22(11-15-25)21-4-2-1-3-5-21/h4,6-17,27,39H,1-3,5,18-19H2,(H,32,35)(H,33,38)(H,36,37) |
| InChIKey | WEDFSHSYOZRYLE-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|