C30H29FN4O6 — CID 20584906
3-[[4-[[4-(cyclohexen-1-yl)-N-[(3-nitrophenyl)carbamoyl]anilino]methyl]benzoyl]amino]-2-fluoropropanoic acid (PubChem CID 20584906) has the molecular formula C30H29FN4O6 and a molecular weight of 560.58 g/mol. Its IUPAC name is 3-[[4-[[4-(cyclohexen-1-yl)-N-[(3-nitrophenyl)carbamoyl]anilino]methyl]benzoyl]amino]-2-fluoropropanoic acid.
| Compound Name | 3-[[4-[[4-(cyclohexen-1-yl)-N-[(3-nitrophenyl)carbamoyl]anilino]methyl]benzoyl]amino]-2-fluoropropanoic acid |
|---|---|
| PubChem CID | 20584906 |
| Molecular Formula | C30H29FN4O6 |
| Molecular Weight | 560.58 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | 3-[[4-[[4-(cyclohexen-1-yl)-N-[(3-nitrophenyl)carbamoyl]anilino]methyl]benzoyl]amino]-2-fluoropropanoic acid |
| SMILES | O=C(NCC(F)C(=O)O)c1ccc(CN(C(=O)Nc2cccc([N+](=O)[O-])c2)c2ccc(C3=CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C30H29FN4O6/c31-27(29(37)38)18-32-28(36)23-11-9-20(10-12-23)19-34(30(39)33-24-7-4-8-26(17-24)35(40)41)25-15-13-22(14-16-25)21-5-2-1-3-6-21/h4-5,7-17,27H,1-3,6,18-19H2,(H,32,36)(H,33,39)(H,37,38) |
| InChIKey | MTGFBLJGGXMIEW-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 141.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.58 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|