C30H29F2N3O4S — CID 67489166
3-[[4-[[4-(cyclohexen-1-yl)-N-[(4-sulfanylphenyl)carbamoyl]anilino]methyl]benzoyl]amino]-2,2-difluoropropanoic acid (PubChem CID 67489166) has the molecular formula C30H29F2N3O4S and a molecular weight of 565.64 g/mol. Its IUPAC name is 3-[[4-[[4-(cyclohexen-1-yl)-N-[(4-sulfanylphenyl)carbamoyl]anilino]methyl]benzoyl]amino]-2,2-difluoropropanoic acid.
| Compound Name | 3-[[4-[[4-(cyclohexen-1-yl)-N-[(4-sulfanylphenyl)carbamoyl]anilino]methyl]benzoyl]amino]-2,2-difluoropropanoic acid |
|---|---|
| PubChem CID | 67489166 |
| Molecular Formula | C30H29F2N3O4S |
| Molecular Weight | 565.64 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | 3-[[4-[[4-(cyclohexen-1-yl)-N-[(4-sulfanylphenyl)carbamoyl]anilino]methyl]benzoyl]amino]-2,2-difluoropropanoic acid |
| SMILES | O=C(NCC(F)(F)C(=O)O)c1ccc(CN(C(=O)Nc2ccc(S)cc2)c2ccc(C3=CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C30H29F2N3O4S/c31-30(32,28(37)38)19-33-27(36)23-8-6-20(7-9-23)18-35(29(39)34-24-12-16-26(40)17-13-24)25-14-10-22(11-15-25)21-4-2-1-3-5-21/h4,6-17,40H,1-3,5,18-19H2,(H,33,36)(H,34,39)(H,37,38) |
| InChIKey | SCQHLVMLRLWTIW-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.64 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|