C36H35F6N3O6 — CID 23526565
3-[[4-[[4-(4-tert-butylcyclohexen-1-yl)-N-[(2,2,4,4-tetrafluoro-1,3-benzodioxin-6-yl)carbamoyl]anilino]methyl]benzoyl]amino]-2,2-difluoropropanoic acid (PubChem CID 23526565) has the molecular formula C36H35F6N3O6 and a molecular weight of 719.68 g/mol. Its IUPAC name is 3-[[4-[[4-(4-tert-butylcyclohexen-1-yl)-N-[(2,2,4,4-tetrafluoro-1,3-benzodioxin-6-yl)carbamoyl]anilino]methyl]benzoyl]amino]-2,2-difluoropropanoic acid.
| Compound Name | 3-[[4-[[4-(4-tert-butylcyclohexen-1-yl)-N-[(2,2,4,4-tetrafluoro-1,3-benzodioxin-6-yl)carbamoyl]anilino]methyl]benzoyl]amino]-2,2-difluoropropanoic acid |
|---|---|
| PubChem CID | 23526565 |
| Molecular Formula | C36H35F6N3O6 |
| Molecular Weight | 719.68 g/mol |
| Exact Mass | 719.24 |
| IUPAC Name | 3-[[4-[[4-(4-tert-butylcyclohexen-1-yl)-N-[(2,2,4,4-tetrafluoro-1,3-benzodioxin-6-yl)carbamoyl]anilino]methyl]benzoyl]amino]-2,2-difluoropropanoic acid |
| SMILES | CC(C)(C)C1CC=C(c2ccc(N(Cc3ccc(C(=O)NCC(F)(F)C(=O)O)cc3)C(=O)Nc3ccc4c(c3)C(F)(F)OC(F)(F)O4)cc2)CC1 |
| InChI | InChI=1S/C36H35F6N3O6/c1-33(2,3)25-12-8-22(9-13-25)23-10-15-27(16-11-23)45(19-21-4-6-24(7-5-21)30(46)43-20-34(37,38)31(47)48)32(49)44-26-14-17-29-28(18-26)35(39,40)51-36(41,42)50-29/h4-8,10-11,14-18,25H,9,12-13,19-20H2,1-3H3,(H,43,46)(H,44,49)(H,47,48) |
| InChIKey | LZTQNAUIMACSDT-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.68 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |