C30H28F3N9O2S — CID 142027458
4-[[N-[[7-amino-5-(trifluoromethyl)-1,3-benzothiazol-2-yl]carbamoyl]-4-(cyclohexen-1-yl)anilino]methyl]-N-(N'-diazenylcarbamimidoyl)benzamide (PubChem CID 142027458) has the molecular formula C30H28F3N9O2S and a molecular weight of 635.68 g/mol. Its IUPAC name is 4-[[N-[[7-amino-5-(trifluoromethyl)-1,3-benzothiazol-2-yl]carbamoyl]-4-(cyclohexen-1-yl)anilino]methyl]-N-(N'-diazenylcarbamimidoyl)benzamide.
| Compound Name | 4-[[N-[[7-amino-5-(trifluoromethyl)-1,3-benzothiazol-2-yl]carbamoyl]-4-(cyclohexen-1-yl)anilino]methyl]-N-(N'-diazenylcarbamimidoyl)benzamide |
|---|---|
| PubChem CID | 142027458 |
| Molecular Formula | C30H28F3N9O2S |
| Molecular Weight | 635.68 g/mol |
| Exact Mass | 635.20 |
| IUPAC Name | 4-[[N-[[7-amino-5-(trifluoromethyl)-1,3-benzothiazol-2-yl]carbamoyl]-4-(cyclohexen-1-yl)anilino]methyl]-N-(N'-diazenylcarbamimidoyl)benzamide |
| SMILES | [H]/N=N/N=C(N)NC(=O)c1ccc(CN(C(=O)Nc2nc3cc(C(F)(F)F)cc(N)c3s2)c2ccc(C3=CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C30H28F3N9O2S/c31-30(32,33)21-14-23(34)25-24(15-21)37-28(45-25)39-29(44)42(22-12-10-19(11-13-22)18-4-2-1-3-5-18)16-17-6-8-20(9-7-17)26(43)38-27(35)40-41-36/h4,6-15H,1-3,5,16,34H2,(H,37,39,44)(H4,35,36,38,40,43) |
| InChIKey | FUSKZWIFLXBOPS-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 174.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.68 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|