C26H27Cl2N7O2S — CID 142027222
4-[[4-cyclohexyl-N-[(2,5-dichlorothiophen-3-yl)carbamoyl]anilino]methyl]-N-(N'-diazenylcarbamimidoyl)benzamide (PubChem CID 142027222) has the molecular formula C26H27Cl2N7O2S and a molecular weight of 572.52 g/mol. Its IUPAC name is 4-[[4-cyclohexyl-N-[(2,5-dichlorothiophen-3-yl)carbamoyl]anilino]methyl]-N-(N'-diazenylcarbamimidoyl)benzamide.
| Compound Name | 4-[[4-cyclohexyl-N-[(2,5-dichlorothiophen-3-yl)carbamoyl]anilino]methyl]-N-(N'-diazenylcarbamimidoyl)benzamide |
|---|---|
| PubChem CID | 142027222 |
| Molecular Formula | C26H27Cl2N7O2S |
| Molecular Weight | 572.52 g/mol |
| Exact Mass | 571.13 |
| IUPAC Name | 4-[[4-cyclohexyl-N-[(2,5-dichlorothiophen-3-yl)carbamoyl]anilino]methyl]-N-(N'-diazenylcarbamimidoyl)benzamide |
| SMILES | [H]/N=N/N=C(N)NC(=O)c1ccc(CN(C(=O)Nc2cc(Cl)sc2Cl)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C26H27Cl2N7O2S/c27-22-14-21(23(28)38-22)31-26(37)35(20-12-10-18(11-13-20)17-4-2-1-3-5-17)15-16-6-8-19(9-7-16)24(36)32-25(29)33-34-30/h6-14,17H,1-5,15H2,(H,31,37)(H4,29,30,32,33,36) |
| InChIKey | MMRJCUAJIWQMSH-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 136.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.52 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|