C30H32F3N7O3 — CID 173338096
4-[[4-cyclohexyl-N-[[2-(trifluoromethoxy)phenyl]carbamoyl]anilino]methyl]-N-(N-methyliminocarbamohydrazonoyl)benzamide (PubChem CID 173338096) has the molecular formula C30H32F3N7O3 and a molecular weight of 595.63 g/mol. Its IUPAC name is 4-[[4-cyclohexyl-N-[[2-(trifluoromethoxy)phenyl]carbamoyl]anilino]methyl]-N-(N-methyliminocarbamohydrazonoyl)benzamide.
| Compound Name | 4-[[4-cyclohexyl-N-[[2-(trifluoromethoxy)phenyl]carbamoyl]anilino]methyl]-N-(N-methyliminocarbamohydrazonoyl)benzamide |
|---|---|
| PubChem CID | 173338096 |
| Molecular Formula | C30H32F3N7O3 |
| Molecular Weight | 595.63 g/mol |
| Exact Mass | 595.25 |
| IUPAC Name | 4-[[4-cyclohexyl-N-[[2-(trifluoromethoxy)phenyl]carbamoyl]anilino]methyl]-N-(N-methyliminocarbamohydrazonoyl)benzamide |
| SMILES | C/N=N/C(=NN)NC(=O)c1ccc(CN(C(=O)Nc2ccccc2OC(F)(F)F)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C30H32F3N7O3/c1-35-39-28(38-34)37-27(41)23-13-11-20(12-14-23)19-40(24-17-15-22(16-18-24)21-7-3-2-4-8-21)29(42)36-25-9-5-6-10-26(25)43-30(31,32)33/h5-6,9-18,21H,2-4,7-8,19,34H2,1H3,(H,36,42)(H,37,38,41)/b39-35+ |
| InChIKey | GUBPUVXQFBHUJV-IGIMMJHKSA-N |
| XLogP | 6.91 |
| TPSA | 133.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.63 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|