C31H36BrN7O2 — CID 173076099
4-[[N-[1-(4-bromophenyl)ethylcarbamoyl]-4-cyclohexylanilino]methyl]-N-(N-methyliminocarbamohydrazonoyl)benzamide (PubChem CID 173076099) has the molecular formula C31H36BrN7O2 and a molecular weight of 618.58 g/mol. Its IUPAC name is 4-[[N-[1-(4-bromophenyl)ethylcarbamoyl]-4-cyclohexylanilino]methyl]-N-(N-methyliminocarbamohydrazonoyl)benzamide.
| Compound Name | 4-[[N-[1-(4-bromophenyl)ethylcarbamoyl]-4-cyclohexylanilino]methyl]-N-(N-methyliminocarbamohydrazonoyl)benzamide |
|---|---|
| PubChem CID | 173076099 |
| Molecular Formula | C31H36BrN7O2 |
| Molecular Weight | 618.58 g/mol |
| Exact Mass | 617.21 |
| IUPAC Name | 4-[[N-[1-(4-bromophenyl)ethylcarbamoyl]-4-cyclohexylanilino]methyl]-N-(N-methyliminocarbamohydrazonoyl)benzamide |
| SMILES | C/N=N/C(=NN)NC(=O)c1ccc(CN(C(=O)NC(C)c2ccc(Br)cc2)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C31H36BrN7O2/c1-21(23-12-16-27(32)17-13-23)35-31(41)39(28-18-14-25(15-19-28)24-6-4-3-5-7-24)20-22-8-10-26(11-9-22)29(40)36-30(37-33)38-34-2/h8-19,21,24H,3-7,20,33H2,1-2H3,(H,35,41)(H,36,37,40)/b38-34+ |
| InChIKey | RDCWMOKKWSIUOT-XCWGLRIOSA-N |
| XLogP | 7.02 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.58 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|