C35H38N6O3 — CID 153259048
4-[[4-cyclohexyl-N-[1-(5-methoxynaphthalen-2-yl)ethylcarbamoyl]anilino]methyl]-N-(N-iminocarbamimidoyl)benzamide (PubChem CID 153259048) has the molecular formula C35H38N6O3 and a molecular weight of 590.73 g/mol. Its IUPAC name is 4-[[4-cyclohexyl-N-[1-(5-methoxynaphthalen-2-yl)ethylcarbamoyl]anilino]methyl]-N-(N-iminocarbamimidoyl)benzamide.
| Compound Name | 4-[[4-cyclohexyl-N-[1-(5-methoxynaphthalen-2-yl)ethylcarbamoyl]anilino]methyl]-N-(N-iminocarbamimidoyl)benzamide |
|---|---|
| PubChem CID | 153259048 |
| Molecular Formula | C35H38N6O3 |
| Molecular Weight | 590.73 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | 4-[[4-cyclohexyl-N-[1-(5-methoxynaphthalen-2-yl)ethylcarbamoyl]anilino]methyl]-N-(N-iminocarbamimidoyl)benzamide |
| SMILES | [H]/N=C(\N=N\[H])NC(=O)c1ccc(CN(C(=O)NC(C)c2ccc3c(OC)cccc3c2)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C35H38N6O3/c1-23(28-17-20-31-29(21-28)9-6-10-32(31)44-2)38-35(43)41(30-18-15-26(16-19-30)25-7-4-3-5-8-25)22-24-11-13-27(14-12-24)33(42)39-34(36)40-37/h6,9-21,23,25,37H,3-5,7-8,22H2,1-2H3,(H,38,43)(H2,36,39,42)/b40-37+ |
| InChIKey | WUVVPVJCIWHCLA-UKRDSVFVSA-N |
| XLogP | 8.07 |
| TPSA | 130.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.73 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|