C30H30Cl2N6O2 — CID 90730367
4-[[4-cyclohexyl-N-[3-(2,6-dichlorophenyl)prop-2-enoyl]anilino]methyl]-N-(didiazenylmethyl)benzamide (PubChem CID 90730367) has the molecular formula C30H30Cl2N6O2 and a molecular weight of 577.52 g/mol. Its IUPAC name is 4-[[4-cyclohexyl-N-[3-(2,6-dichlorophenyl)prop-2-enoyl]anilino]methyl]-N-(didiazenylmethyl)benzamide.
| Compound Name | 4-[[4-cyclohexyl-N-[3-(2,6-dichlorophenyl)prop-2-enoyl]anilino]methyl]-N-(didiazenylmethyl)benzamide |
|---|---|
| PubChem CID | 90730367 |
| Molecular Formula | C30H30Cl2N6O2 |
| Molecular Weight | 577.52 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | 4-[[4-cyclohexyl-N-[3-(2,6-dichlorophenyl)prop-2-enoyl]anilino]methyl]-N-(didiazenylmethyl)benzamide |
| SMILES | [H]/N=N/C(/N=N/[H])NC(=O)c1ccc(CN(C(=O)C=Cc2c(Cl)cccc2Cl)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C30H30Cl2N6O2/c31-26-7-4-8-27(32)25(26)17-18-28(39)38(24-15-13-22(14-16-24)21-5-2-1-3-6-21)19-20-9-11-23(12-10-20)29(40)35-30(36-33)37-34/h4,7-18,21,30,33-34H,1-3,5-6,19H2,(H,35,40)/b18-17?,36-33+,37-34+ |
| InChIKey | NFGHSBHVZSXFPV-QJAFGEHQSA-N |
| XLogP | 8.36 |
| TPSA | 121.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.52 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|