C34H41N6O2+ — CID 163818251
[N-[4-[(4-cyclohexyl-N-(4-cyclohexylbenzoyl)anilino)methyl]benzoyl]carbamohydrazonoyl]iminoazanium (PubChem CID 163818251) has the molecular formula C34H41N6O2+ and a molecular weight of 565.74 g/mol. Its IUPAC name is [N-[4-[(4-cyclohexyl-N-(4-cyclohexylbenzoyl)anilino)methyl]benzoyl]carbamohydrazonoyl]iminoazanium.
| Compound Name | [N-[4-[(4-cyclohexyl-N-(4-cyclohexylbenzoyl)anilino)methyl]benzoyl]carbamohydrazonoyl]iminoazanium |
|---|---|
| PubChem CID | 163818251 |
| Molecular Formula | C34H41N6O2+ |
| Molecular Weight | 565.74 g/mol |
| Exact Mass | 565.33 |
| IUPAC Name | [N-[4-[(4-cyclohexyl-N-(4-cyclohexylbenzoyl)anilino)methyl]benzoyl]carbamohydrazonoyl]iminoazanium |
| SMILES | NN=C(N=[NH2+])NC(=O)c1ccc(CN(C(=O)c2ccc(C3CCCCC3)cc2)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C34H40N6O2/c35-38-34(39-36)37-32(41)29-13-11-24(12-14-29)23-40(31-21-19-28(20-22-31)26-9-5-2-6-10-26)33(42)30-17-15-27(16-18-30)25-7-3-1-4-8-25/h11-22,25-26,35H,1-10,23,36H2,(H,37,39,41)/p+1 |
| InChIKey | NTEHQBKEDXWBLE-UHFFFAOYSA-O |
| XLogP | 5.80 |
| TPSA | 125.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.74 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|