C31H35N7O4 — CID 173338116
4-[[4-cyclohexyl-N-[4-(4-nitrophenyl)butanoyl]anilino]methyl]-N-(N'-diazenylcarbamimidoyl)benzamide (PubChem CID 173338116) has the molecular formula C31H35N7O4 and a molecular weight of 569.67 g/mol. Its IUPAC name is 4-[[4-cyclohexyl-N-[4-(4-nitrophenyl)butanoyl]anilino]methyl]-N-(N'-diazenylcarbamimidoyl)benzamide.
| Compound Name | 4-[[4-cyclohexyl-N-[4-(4-nitrophenyl)butanoyl]anilino]methyl]-N-(N'-diazenylcarbamimidoyl)benzamide |
|---|---|
| PubChem CID | 173338116 |
| Molecular Formula | C31H35N7O4 |
| Molecular Weight | 569.67 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | 4-[[4-cyclohexyl-N-[4-(4-nitrophenyl)butanoyl]anilino]methyl]-N-(N'-diazenylcarbamimidoyl)benzamide |
| SMILES | [H]/N=N/N=C(N)NC(=O)c1ccc(CN(C(=O)CCCc2ccc([N+](=O)[O-])cc2)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C31H35N7O4/c32-31(35-36-33)34-30(40)26-13-9-23(10-14-26)21-37(27-19-15-25(16-20-27)24-6-2-1-3-7-24)29(39)8-4-5-22-11-17-28(18-12-22)38(41)42/h9-20,24H,1-8,21H2,(H4,32,33,34,35,40) |
| InChIKey | AWWWOSUSAHVFFH-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 167.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.67 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|