C30H33N7O6 — CID 136649422
dimethyl 5-[[(4-butan-2-ylphenyl)-[[4-[(N'-diazenylcarbamimidoyl)carbamoyl]phenyl]methyl]carbamoyl]amino]benzene-1,3-dicarboxylate (PubChem CID 136649422) has the molecular formula C30H33N7O6 and a molecular weight of 587.64 g/mol. Its IUPAC name is dimethyl 5-[[(4-butan-2-ylphenyl)-[[4-[(N'-diazenylcarbamimidoyl)carbamoyl]phenyl]methyl]carbamoyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[(4-butan-2-ylphenyl)-[[4-[(N'-diazenylcarbamimidoyl)carbamoyl]phenyl]methyl]carbamoyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 136649422 |
| Molecular Formula | C30H33N7O6 |
| Molecular Weight | 587.64 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | dimethyl 5-[[(4-butan-2-ylphenyl)-[[4-[(N'-diazenylcarbamimidoyl)carbamoyl]phenyl]methyl]carbamoyl]amino]benzene-1,3-dicarboxylate |
| SMILES | [H]/N=N/N=C(N)NC(=O)c1ccc(CN(C(=O)Nc2cc(C(=O)OC)cc(C(=O)OC)c2)c2ccc(C(C)CC)cc2)cc1 |
| InChI | InChI=1S/C30H33N7O6/c1-5-18(2)20-10-12-25(13-11-20)37(17-19-6-8-21(9-7-19)26(38)34-29(31)35-36-32)30(41)33-24-15-22(27(39)42-3)14-23(16-24)28(40)43-4/h6-16,18H,5,17H2,1-4H3,(H,33,41)(H4,31,32,34,35,38) |
| InChIKey | DJPXJMCVLUYLEU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 188.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.64 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|