C12H12BrN3O5 — CID 24879044
methyl 3-[(2-bromoacetyl)amino]-5-(carbamoylcarbamoyl)benzoate (PubChem CID 24879044) has the molecular formula C12H12BrN3O5 and a molecular weight of 358.15 g/mol. Its IUPAC name is methyl 3-[(2-bromoacetyl)amino]-5-(carbamoylcarbamoyl)benzoate.
| Compound Name | methyl 3-[(2-bromoacetyl)amino]-5-(carbamoylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 24879044 |
| Molecular Formula | C12H12BrN3O5 |
| Molecular Weight | 358.15 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | methyl 3-[(2-bromoacetyl)amino]-5-(carbamoylcarbamoyl)benzoate |
| SMILES | COC(=O)c1cc(NC(=O)CBr)cc(C(=O)NC(N)=O)c1 |
| InChI | InChI=1S/C12H12BrN3O5/c1-21-11(19)7-2-6(10(18)16-12(14)20)3-8(4-7)15-9(17)5-13/h2-4H,5H2,1H3,(H,15,17)(H3,14,16,18,20) |
| InChIKey | KKQJWALEBWHRKQ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.15 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|