C32H40N8O3 — CID 142027503
3-[[[4-[(N'-diazenylcarbamimidoyl)carbamoyl]phenyl]methyl-[4-(3,4-dimethylhexan-3-yl)phenyl]carbamoyl]amino]-N-methylbenzamide (PubChem CID 142027503) has the molecular formula C32H40N8O3 and a molecular weight of 584.73 g/mol. Its IUPAC name is 3-[[[4-[(N'-diazenylcarbamimidoyl)carbamoyl]phenyl]methyl-[4-(3,4-dimethylhexan-3-yl)phenyl]carbamoyl]amino]-N-methylbenzamide.
| Compound Name | 3-[[[4-[(N'-diazenylcarbamimidoyl)carbamoyl]phenyl]methyl-[4-(3,4-dimethylhexan-3-yl)phenyl]carbamoyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 142027503 |
| Molecular Formula | C32H40N8O3 |
| Molecular Weight | 584.73 g/mol |
| Exact Mass | 584.32 |
| IUPAC Name | 3-[[[4-[(N'-diazenylcarbamimidoyl)carbamoyl]phenyl]methyl-[4-(3,4-dimethylhexan-3-yl)phenyl]carbamoyl]amino]-N-methylbenzamide |
| SMILES | [H]/N=N/N=C(N)NC(=O)c1ccc(CN(C(=O)Nc2cccc(C(=O)NC)c2)c2ccc(C(C)(CC)C(C)CC)cc2)cc1 |
| InChI | InChI=1S/C32H40N8O3/c1-6-21(3)32(4,7-2)25-15-17-27(18-16-25)40(31(43)36-26-10-8-9-24(19-26)28(41)35-5)20-22-11-13-23(14-12-22)29(42)37-30(33)38-39-34/h8-19,21H,6-7,20H2,1-5H3,(H,35,41)(H,36,43)(H4,33,34,37,38,42) |
| InChIKey | FVHFEZQIGBOILC-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 165.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.73 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|