C33H26F5N7O4 — CID 18346946
(2,3,4,5,6-pentafluorophenyl) 3-[[(4-tert-butylphenyl)-[[4-(2H-tetrazol-5-ylcarbamoyl)phenyl]methyl]carbamoyl]amino]benzoate (PubChem CID 18346946) has the molecular formula C33H26F5N7O4 and a molecular weight of 679.61 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-[[(4-tert-butylphenyl)-[[4-(2H-tetrazol-5-ylcarbamoyl)phenyl]methyl]carbamoyl]amino]benzoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-[[(4-tert-butylphenyl)-[[4-(2H-tetrazol-5-ylcarbamoyl)phenyl]methyl]carbamoyl]amino]benzoate |
|---|---|
| PubChem CID | 18346946 |
| Molecular Formula | C33H26F5N7O4 |
| Molecular Weight | 679.61 g/mol |
| Exact Mass | 679.20 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-[[(4-tert-butylphenyl)-[[4-(2H-tetrazol-5-ylcarbamoyl)phenyl]methyl]carbamoyl]amino]benzoate |
| SMILES | CC(C)(C)c1ccc(N(Cc2ccc(C(=O)Nc3nn[nH]n3)cc2)C(=O)Nc2cccc(C(=O)Oc3c(F)c(F)c(F)c(F)c3F)c2)cc1 |
| InChI | InChI=1S/C33H26F5N7O4/c1-33(2,3)20-11-13-22(14-12-20)45(16-17-7-9-18(10-8-17)29(46)40-31-41-43-44-42-31)32(48)39-21-6-4-5-19(15-21)30(47)49-28-26(37)24(35)23(34)25(36)27(28)38/h4-15H,16H2,1-3H3,(H,39,48)(H2,40,41,42,43,44,46) |
| InChIKey | MVGMRFYHGMDXNR-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 142.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.61 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|