C28H29F3N8O3 — CID 163449740
N-(N'-diazenylcarbamimidoyl)-4-[[4-piperidin-1-yl-N-[[4-(trifluoromethoxy)phenyl]carbamoyl]anilino]methyl]benzamide (PubChem CID 163449740) has the molecular formula C28H29F3N8O3 and a molecular weight of 582.59 g/mol. Its IUPAC name is N-(N'-diazenylcarbamimidoyl)-4-[[4-piperidin-1-yl-N-[[4-(trifluoromethoxy)phenyl]carbamoyl]anilino]methyl]benzamide.
| Compound Name | N-(N'-diazenylcarbamimidoyl)-4-[[4-piperidin-1-yl-N-[[4-(trifluoromethoxy)phenyl]carbamoyl]anilino]methyl]benzamide |
|---|---|
| PubChem CID | 163449740 |
| Molecular Formula | C28H29F3N8O3 |
| Molecular Weight | 582.59 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | N-(N'-diazenylcarbamimidoyl)-4-[[4-piperidin-1-yl-N-[[4-(trifluoromethoxy)phenyl]carbamoyl]anilino]methyl]benzamide |
| SMILES | [H]/N=N/N=C(N)NC(=O)c1ccc(CN(C(=O)Nc2ccc(OC(F)(F)F)cc2)c2ccc(N3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C28H29F3N8O3/c29-28(30,31)42-24-14-8-21(9-15-24)34-27(41)39(23-12-10-22(11-13-23)38-16-2-1-3-17-38)18-19-4-6-20(7-5-19)25(40)35-26(32)36-37-33/h4-15H,1-3,16-18H2,(H,34,41)(H4,32,33,35,36,40) |
| InChIKey | BFPANZCJGXLMOE-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 148.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.59 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|