C24H19ClF6N7O3+ — CID 142027693
[amino-[(Z)-aminodiazenyl]methylidene]-[4-[[N-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl]-4-(trifluoromethoxy)anilino]methyl]benzoyl]azanium (PubChem CID 142027693) has the molecular formula C24H19ClF6N7O3+ and a molecular weight of 602.90 g/mol. Its IUPAC name is [amino-[(Z)-aminodiazenyl]methylidene]-[4-[[N-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl]-4-(trifluoromethoxy)anilino]methyl]benzoyl]azanium.
| Compound Name | [amino-[(Z)-aminodiazenyl]methylidene]-[4-[[N-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl]-4-(trifluoromethoxy)anilino]methyl]benzoyl]azanium |
|---|---|
| PubChem CID | 142027693 |
| Molecular Formula | C24H19ClF6N7O3+ |
| Molecular Weight | 602.90 g/mol |
| Exact Mass | 602.11 |
| IUPAC Name | [amino-[(Z)-aminodiazenyl]methylidene]-[4-[[N-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl]-4-(trifluoromethoxy)anilino]methyl]benzoyl]azanium |
| SMILES | N/N=N\C(N)=[NH+]/C(=O)c1ccc(CN(C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H18ClF6N7O3/c25-19-10-5-15(11-18(19)23(26,27)28)34-22(40)38(16-6-8-17(9-7-16)41-24(29,30)31)12-13-1-3-14(4-2-13)20(39)35-21(32)36-37-33/h1-11H,12H2,(H,34,40)(H4,32,33,35,36,39)/p+1 |
| InChIKey | XQMYTRBYHXJRNK-UHFFFAOYSA-O |
| XLogP | 4.36 |
| TPSA | 149.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.90 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|