C29H32F3N3O6 — CID 142027585
3-[[[4-[[4-butoxy-N-[[4-(trifluoromethoxy)phenyl]carbamoyl]anilino]methyl]phenyl]-hydroxymethyl]amino]propanoic acid (PubChem CID 142027585) has the molecular formula C29H32F3N3O6 and a molecular weight of 575.58 g/mol. Its IUPAC name is 3-[[[4-[[4-butoxy-N-[[4-(trifluoromethoxy)phenyl]carbamoyl]anilino]methyl]phenyl]-hydroxymethyl]amino]propanoic acid.
| Compound Name | 3-[[[4-[[4-butoxy-N-[[4-(trifluoromethoxy)phenyl]carbamoyl]anilino]methyl]phenyl]-hydroxymethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 142027585 |
| Molecular Formula | C29H32F3N3O6 |
| Molecular Weight | 575.58 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | 3-[[[4-[[4-butoxy-N-[[4-(trifluoromethoxy)phenyl]carbamoyl]anilino]methyl]phenyl]-hydroxymethyl]amino]propanoic acid |
| SMILES | CCCCOc1ccc(N(Cc2ccc(C(O)NCCC(=O)O)cc2)C(=O)Nc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C29H32F3N3O6/c1-2-3-18-40-24-14-10-23(11-15-24)35(28(39)34-22-8-12-25(13-9-22)41-29(30,31)32)19-20-4-6-21(7-5-20)27(38)33-17-16-26(36)37/h4-15,27,33,38H,2-3,16-19H2,1H3,(H,34,39)(H,36,37) |
| InChIKey | DJNMDIQOMANGCN-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.58 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|