C26H24F3NO4 — CID 66961321
2-[N-[(4-butylphenyl)methyl]-4-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetic acid (PubChem CID 66961321) has the molecular formula C26H24F3NO4 and a molecular weight of 471.48 g/mol. Its IUPAC name is 2-[N-[(4-butylphenyl)methyl]-4-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetic acid.
| Compound Name | 2-[N-[(4-butylphenyl)methyl]-4-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 66961321 |
| Molecular Formula | C26H24F3NO4 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 2-[N-[(4-butylphenyl)methyl]-4-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetic acid |
| SMILES | CCCCc1ccc(CN(C(=O)C(=O)O)c2ccc(-c3ccc(OC(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H24F3NO4/c1-2-3-4-18-5-7-19(8-6-18)17-30(24(31)25(32)33)22-13-9-20(10-14-22)21-11-15-23(16-12-21)34-26(27,28)29/h5-16H,2-4,17H2,1H3,(H,32,33) |
| InChIKey | MTMRPHXBGHFLRY-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|