C30H32F3NO5 — CID 58008136
methyl 2-[4-butoxy-N-(4-phenylbutyl)-3-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetate (PubChem CID 58008136) has the molecular formula C30H32F3NO5 and a molecular weight of 543.58 g/mol. Its IUPAC name is methyl 2-[4-butoxy-N-(4-phenylbutyl)-3-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetate.
| Compound Name | methyl 2-[4-butoxy-N-(4-phenylbutyl)-3-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetate |
|---|---|
| PubChem CID | 58008136 |
| Molecular Formula | C30H32F3NO5 |
| Molecular Weight | 543.58 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | methyl 2-[4-butoxy-N-(4-phenylbutyl)-3-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetate |
| SMILES | CCCCOc1ccc(N(CCCCc2ccccc2)C(=O)C(=O)OC)cc1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C30H32F3NO5/c1-3-4-20-38-27-18-15-24(21-26(27)23-13-16-25(17-14-23)39-30(31,32)33)34(28(35)29(36)37-2)19-9-8-12-22-10-6-5-7-11-22/h5-7,10-11,13-18,21H,3-4,8-9,12,19-20H2,1-2H3 |
| InChIKey | MHDYEYRIFTWFFX-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.58 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|