C34H39F2NO5 — CID 143874975
methyl 2-[2-cycloheptyloxy-5-[4-(1,1-difluoroethoxy)phenyl]-N-(4-phenylbutyl)anilino]-2-oxoacetate (PubChem CID 143874975) has the molecular formula C34H39F2NO5 and a molecular weight of 579.68 g/mol. Its IUPAC name is methyl 2-[2-cycloheptyloxy-5-[4-(1,1-difluoroethoxy)phenyl]-N-(4-phenylbutyl)anilino]-2-oxoacetate.
| Compound Name | methyl 2-[2-cycloheptyloxy-5-[4-(1,1-difluoroethoxy)phenyl]-N-(4-phenylbutyl)anilino]-2-oxoacetate |
|---|---|
| PubChem CID | 143874975 |
| Molecular Formula | C34H39F2NO5 |
| Molecular Weight | 579.68 g/mol |
| Exact Mass | 579.28 |
| IUPAC Name | methyl 2-[2-cycloheptyloxy-5-[4-(1,1-difluoroethoxy)phenyl]-N-(4-phenylbutyl)anilino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)N(CCCCc1ccccc1)c1cc(-c2ccc(OC(C)(F)F)cc2)ccc1OC1CCCCCC1 |
| InChI | InChI=1S/C34H39F2NO5/c1-34(35,36)42-29-20-17-26(18-21-29)27-19-22-31(41-28-15-8-3-4-9-16-28)30(24-27)37(32(38)33(39)40-2)23-11-10-14-25-12-6-5-7-13-25/h5-7,12-13,17-22,24,28H,3-4,8-11,14-16,23H2,1-2H3 |
| InChIKey | HKRXLGSOIRHOSE-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.68 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|