C30H34F3NO4 — CID 58007942
5-[2-(4-phenylbutylamino)-4-[4-(trifluoromethoxy)phenyl]phenoxy]pentyl acetate (PubChem CID 58007942) has the molecular formula C30H34F3NO4 and a molecular weight of 529.60 g/mol. Its IUPAC name is 5-[2-(4-phenylbutylamino)-4-[4-(trifluoromethoxy)phenyl]phenoxy]pentyl acetate.
| Compound Name | 5-[2-(4-phenylbutylamino)-4-[4-(trifluoromethoxy)phenyl]phenoxy]pentyl acetate |
|---|---|
| PubChem CID | 58007942 |
| Molecular Formula | C30H34F3NO4 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | 5-[2-(4-phenylbutylamino)-4-[4-(trifluoromethoxy)phenyl]phenoxy]pentyl acetate |
| SMILES | CC(=O)OCCCCCOc1ccc(-c2ccc(OC(F)(F)F)cc2)cc1NCCCCc1ccccc1 |
| InChI | InChI=1S/C30H34F3NO4/c1-23(35)36-20-8-3-9-21-37-29-18-15-26(25-13-16-27(17-14-25)38-30(31,32)33)22-28(29)34-19-7-6-12-24-10-4-2-5-11-24/h2,4-5,10-11,13-18,22,34H,3,6-9,12,19-21H2,1H3 |
| InChIKey | HCGMAAASWBLCKW-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|