C32H28F3NO5 — CID 58008071
methyl 2-oxo-2-[2-phenoxy-N-(4-phenylbutyl)-5-[4-(trifluoromethoxy)phenyl]anilino]acetate (PubChem CID 58008071) has the molecular formula C32H28F3NO5 and a molecular weight of 563.57 g/mol. Its IUPAC name is methyl 2-oxo-2-[2-phenoxy-N-(4-phenylbutyl)-5-[4-(trifluoromethoxy)phenyl]anilino]acetate.
| Compound Name | methyl 2-oxo-2-[2-phenoxy-N-(4-phenylbutyl)-5-[4-(trifluoromethoxy)phenyl]anilino]acetate |
|---|---|
| PubChem CID | 58008071 |
| Molecular Formula | C32H28F3NO5 |
| Molecular Weight | 563.57 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | methyl 2-oxo-2-[2-phenoxy-N-(4-phenylbutyl)-5-[4-(trifluoromethoxy)phenyl]anilino]acetate |
| SMILES | COC(=O)C(=O)N(CCCCc1ccccc1)c1cc(-c2ccc(OC(F)(F)F)cc2)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C32H28F3NO5/c1-39-31(38)30(37)36(21-9-8-12-23-10-4-2-5-11-23)28-22-25(17-20-29(28)40-26-13-6-3-7-14-26)24-15-18-27(19-16-24)41-32(33,34)35/h2-7,10-11,13-20,22H,8-9,12,21H2,1H3 |
| InChIKey | RHLAVXNISQDWDG-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.57 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|