C37H44F3NO5 — CID 143874869
methyl 2-[2-(4-ethyl-6-methylcyclooctyl)oxy-N-(4-phenylbutyl)-5-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetate (PubChem CID 143874869) has the molecular formula C37H44F3NO5 and a molecular weight of 639.76 g/mol. Its IUPAC name is methyl 2-[2-(4-ethyl-6-methylcyclooctyl)oxy-N-(4-phenylbutyl)-5-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetate.
| Compound Name | methyl 2-[2-(4-ethyl-6-methylcyclooctyl)oxy-N-(4-phenylbutyl)-5-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetate |
|---|---|
| PubChem CID | 143874869 |
| Molecular Formula | C37H44F3NO5 |
| Molecular Weight | 639.76 g/mol |
| Exact Mass | 639.32 |
| IUPAC Name | methyl 2-[2-(4-ethyl-6-methylcyclooctyl)oxy-N-(4-phenylbutyl)-5-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetate |
| SMILES | CCC1CCC(Oc2ccc(-c3ccc(OC(F)(F)F)cc3)cc2N(CCCCc2ccccc2)C(=O)C(=O)OC)CCC(C)C1 |
| InChI | InChI=1S/C37H44F3NO5/c1-4-27-14-19-31(18-13-26(2)24-27)45-34-22-17-30(29-15-20-32(21-16-29)46-37(38,39)40)25-33(34)41(35(42)36(43)44-3)23-9-8-12-28-10-6-5-7-11-28/h5-7,10-11,15-17,20-22,25-27,31H,4,8-9,12-14,18-19,23-24H2,1-3H3 |
| InChIKey | PVBAZWHDMGYEKY-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.76 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|