C42H57F2NO4 — CID 143874870
2,2-difluoro-5-methylhexane;methyl 2-[4-(4-cyclobutylphenyl)-2-hexoxy-N-(4-phenylbutyl)anilino]-2-oxoacetate (PubChem CID 143874870) has the molecular formula C42H57F2NO4 and a molecular weight of 677.92 g/mol. Its IUPAC name is 2,2-difluoro-5-methylhexane;methyl 2-[4-(4-cyclobutylphenyl)-2-hexoxy-N-(4-phenylbutyl)anilino]-2-oxoacetate.
| Compound Name | 2,2-difluoro-5-methylhexane;methyl 2-[4-(4-cyclobutylphenyl)-2-hexoxy-N-(4-phenylbutyl)anilino]-2-oxoacetate |
|---|---|
| PubChem CID | 143874870 |
| Molecular Formula | C42H57F2NO4 |
| Molecular Weight | 677.92 g/mol |
| Exact Mass | 677.43 |
| IUPAC Name | 2,2-difluoro-5-methylhexane;methyl 2-[4-(4-cyclobutylphenyl)-2-hexoxy-N-(4-phenylbutyl)anilino]-2-oxoacetate |
| SMILES | CC(C)CCC(C)(F)F.CCCCCCOc1cc(-c2ccc(C3CCC3)cc2)ccc1N(CCCCc1ccccc1)C(=O)C(=O)OC |
| InChI | InChI=1S/C35H43NO4.C7H14F2/c1-3-4-5-11-25-40-33-26-31(30-20-18-29(19-21-30)28-16-12-17-28)22-23-32(33)36(34(37)35(38)39-2)24-10-9-15-27-13-7-6-8-14-27;1-6(2)4-5-7(3,8)9/h6-8,13-14,18-23,26,28H,3-5,9-12,15-17,24-25H2,1-2H3;6H,4-5H2,1-3H3 |
| InChIKey | MLVHTOQYLWLTQR-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.92 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|