C27H26F3NO6 — CID 58007623
methyl 2-[2-methoxy-N-(4-phenoxybutyl)-5-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetate (PubChem CID 58007623) has the molecular formula C27H26F3NO6 and a molecular weight of 517.50 g/mol. Its IUPAC name is methyl 2-[2-methoxy-N-(4-phenoxybutyl)-5-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetate.
| Compound Name | methyl 2-[2-methoxy-N-(4-phenoxybutyl)-5-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetate |
|---|---|
| PubChem CID | 58007623 |
| Molecular Formula | C27H26F3NO6 |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | methyl 2-[2-methoxy-N-(4-phenoxybutyl)-5-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)N(CCCCOc1ccccc1)c1cc(-c2ccc(OC(F)(F)F)cc2)ccc1OC |
| InChI | InChI=1S/C27H26F3NO6/c1-34-24-15-12-20(19-10-13-22(14-11-19)37-27(28,29)30)18-23(24)31(25(32)26(33)35-2)16-6-7-17-36-21-8-4-3-5-9-21/h3-5,8-15,18H,6-7,16-17H2,1-2H3 |
| InChIKey | JMBORLVFVFNDJR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|