C23H17F4NO4 — CID 59820829
methyl 2-[N-[(4-fluorophenyl)methyl]-4-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetate (PubChem CID 59820829) has the molecular formula C23H17F4NO4 and a molecular weight of 447.38 g/mol. Its IUPAC name is methyl 2-[N-[(4-fluorophenyl)methyl]-4-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetate.
| Compound Name | methyl 2-[N-[(4-fluorophenyl)methyl]-4-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetate |
|---|---|
| PubChem CID | 59820829 |
| Molecular Formula | C23H17F4NO4 |
| Molecular Weight | 447.38 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | methyl 2-[N-[(4-fluorophenyl)methyl]-4-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)N(Cc1ccc(F)cc1)c1ccc(-c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H17F4NO4/c1-31-22(30)21(29)28(14-15-2-8-18(24)9-3-15)19-10-4-16(5-11-19)17-6-12-20(13-7-17)32-23(25,26)27/h2-13H,14H2,1H3 |
| InChIKey | SCBSSYUWGBMSNA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.38 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|