C24H17F6NO4 — CID 143656018
methyl 2-[N-benzyl-4-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)anilino]-2-oxoacetate (PubChem CID 143656018) has the molecular formula C24H17F6NO4 and a molecular weight of 497.39 g/mol. Its IUPAC name is methyl 2-[N-benzyl-4-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)anilino]-2-oxoacetate.
| Compound Name | methyl 2-[N-benzyl-4-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)anilino]-2-oxoacetate |
|---|---|
| PubChem CID | 143656018 |
| Molecular Formula | C24H17F6NO4 |
| Molecular Weight | 497.39 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | methyl 2-[N-benzyl-4-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)anilino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)N(Cc1ccccc1)c1ccc(-c2ccc(OC(F)(F)F)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H17F6NO4/c1-34-22(33)21(32)31(14-15-5-3-2-4-6-15)17-9-12-19(20(13-17)23(25,26)27)16-7-10-18(11-8-16)35-24(28,29)30/h2-13H,14H2,1H3 |
| InChIKey | AOUHCIBMCBILPS-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.39 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|