C27H23F6NO4 — CID 87216567
2-[N-[(4-tert-butylphenyl)methyl]-2-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)anilino]-2-oxoacetic acid (PubChem CID 87216567) has the molecular formula C27H23F6NO4 and a molecular weight of 539.47 g/mol. Its IUPAC name is 2-[N-[(4-tert-butylphenyl)methyl]-2-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)anilino]-2-oxoacetic acid.
| Compound Name | 2-[N-[(4-tert-butylphenyl)methyl]-2-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)anilino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 87216567 |
| Molecular Formula | C27H23F6NO4 |
| Molecular Weight | 539.47 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | 2-[N-[(4-tert-butylphenyl)methyl]-2-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)anilino]-2-oxoacetic acid |
| SMILES | CC(C)(C)c1ccc(CN(C(=O)C(=O)O)c2cc(C(F)(F)F)ccc2-c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C27H23F6NO4/c1-25(2,3)18-8-4-16(5-9-18)15-34(23(35)24(36)37)22-14-19(26(28,29)30)10-13-21(22)17-6-11-20(12-7-17)38-27(31,32)33/h4-14H,15H2,1-3H3,(H,36,37) |
| InChIKey | JEMDLWLSMUDAQB-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.47 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|