C33H30F3NO5 — CID 66962192
2-[N-[(4-tert-butylphenyl)methyl]-2-(4-methoxyphenyl)-3-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetic acid (PubChem CID 66962192) has the molecular formula C33H30F3NO5 and a molecular weight of 577.60 g/mol. Its IUPAC name is 2-[N-[(4-tert-butylphenyl)methyl]-2-(4-methoxyphenyl)-3-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetic acid.
| Compound Name | 2-[N-[(4-tert-butylphenyl)methyl]-2-(4-methoxyphenyl)-3-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 66962192 |
| Molecular Formula | C33H30F3NO5 |
| Molecular Weight | 577.60 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | 2-[N-[(4-tert-butylphenyl)methyl]-2-(4-methoxyphenyl)-3-[4-(trifluoromethoxy)phenyl]anilino]-2-oxoacetic acid |
| SMILES | COc1ccc(-c2c(-c3ccc(OC(F)(F)F)cc3)cccc2N(Cc2ccc(C(C)(C)C)cc2)C(=O)C(=O)O)cc1 |
| InChI | InChI=1S/C33H30F3NO5/c1-32(2,3)24-14-8-21(9-15-24)20-37(30(38)31(39)40)28-7-5-6-27(29(28)23-12-16-25(41-4)17-13-23)22-10-18-26(19-11-22)42-33(34,35)36/h5-19H,20H2,1-4H3,(H,39,40) |
| InChIKey | KTXKTHVAKHFFRQ-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.60 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|